C10H14N2OS — CID 6088045
N-[(Z)-pentan-2-ylideneamino]thiophene-2-carboxamide (PubChem CID 6088045) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is N-[(Z)-pentan-2-ylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(Z)-pentan-2-ylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 6088045 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | N-[(Z)-pentan-2-ylideneamino]thiophene-2-carboxamide |
| SMILES | CCC/C(C)=N\NC(=O)c1cccs1 |
| InChI | InChI=1S/C10H14N2OS/c1-3-5-8(2)11-12-10(13)9-6-4-7-14-9/h4,6-7H,3,5H2,1-2H3,(H,12,13)/b11-8- |
| InChIKey | FHAJUQPJXSPCQN-FLIBITNWSA-N |
| XLogP | 2.65 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|