C12H10N2O3S2 — CID 6309805
5-[(Z)-C-methyl-N-(thiophene-2-carbonylamino)carbonimidoyl]thiophene-2-carboxylic acid (PubChem CID 6309805) has the molecular formula C12H10N2O3S2 and a molecular weight of 294.36 g/mol. Its IUPAC name is 5-[(Z)-C-methyl-N-(thiophene-2-carbonylamino)carbonimidoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[(Z)-C-methyl-N-(thiophene-2-carbonylamino)carbonimidoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 6309805 |
| Molecular Formula | C12H10N2O3S2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 5-[(Z)-C-methyl-N-(thiophene-2-carbonylamino)carbonimidoyl]thiophene-2-carboxylic acid |
| SMILES | C/C(=N/NC(=O)c1cccs1)c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C12H10N2O3S2/c1-7(8-4-5-10(19-8)12(16)17)13-14-11(15)9-3-2-6-18-9/h2-6H,1H3,(H,14,15)(H,16,17)/b13-7- |
| InChIKey | GOCYXRBEEYOZTK-QPEQYQDCSA-N |
| XLogP | 2.66 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|