C17H14BrClN2OS2 — CID 5213778
6-bromo-3-chloro-N-(1-thiophen-2-ylbutylideneamino)-1-benzothiophene-2-carboxamide (PubChem CID 5213778) has the molecular formula C17H14BrClN2OS2 and a molecular weight of 441.80 g/mol. Its IUPAC name is 6-bromo-3-chloro-N-(1-thiophen-2-ylbutylideneamino)-1-benzothiophene-2-carboxamide.
| Compound Name | 6-bromo-3-chloro-N-(1-thiophen-2-ylbutylideneamino)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 5213778 |
| Molecular Formula | C17H14BrClN2OS2 |
| Molecular Weight | 441.80 g/mol |
| Exact Mass | 439.94 |
| IUPAC Name | 6-bromo-3-chloro-N-(1-thiophen-2-ylbutylideneamino)-1-benzothiophene-2-carboxamide |
| SMILES | CCCC(=NNC(=O)c1sc2cc(Br)ccc2c1Cl)c1cccs1 |
| InChI | InChI=1S/C17H14BrClN2OS2/c1-2-4-12(13-5-3-8-23-13)20-21-17(22)16-15(19)11-7-6-10(18)9-14(11)24-16/h3,5-9H,2,4H2,1H3,(H,21,22) |
| InChIKey | OBAYHSJRBWCIEU-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.80 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|