C18H13ClF2N2O2S2 — CID 172959957
3-chloro-N-[(Z)-(4,4-difluoro-1-oxo-1-thiophen-2-ylpentan-3-ylidene)amino]-1-benzothiophene-2-carboxamide (PubChem CID 172959957) has the molecular formula C18H13ClF2N2O2S2 and a molecular weight of 426.90 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-(4,4-difluoro-1-oxo-1-thiophen-2-ylpentan-3-ylidene)amino]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(Z)-(4,4-difluoro-1-oxo-1-thiophen-2-ylpentan-3-ylidene)amino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 172959957 |
| Molecular Formula | C18H13ClF2N2O2S2 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | 3-chloro-N-[(Z)-(4,4-difluoro-1-oxo-1-thiophen-2-ylpentan-3-ylidene)amino]-1-benzothiophene-2-carboxamide |
| SMILES | CC(F)(F)/C(CC(=O)c1cccs1)=N\NC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C18H13ClF2N2O2S2/c1-18(20,21)14(9-11(24)13-7-4-8-26-13)22-23-17(25)16-15(19)10-5-2-3-6-12(10)27-16/h2-8H,9H2,1H3,(H,23,25)/b22-14- |
| InChIKey | FBFXLCRBPMRHJF-HMAPJEAMSA-N |
| XLogP | 5.63 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|