C17H11ClF3N3O2S — CID 87270428
3-chloro-N-[(Z)-(1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbutan-2-ylidene)amino]-1H-indole-2-carboxamide (PubChem CID 87270428) has the molecular formula C17H11ClF3N3O2S and a molecular weight of 413.81 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-(1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbutan-2-ylidene)amino]-1H-indole-2-carboxamide.
| Compound Name | 3-chloro-N-[(Z)-(1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbutan-2-ylidene)amino]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 87270428 |
| Molecular Formula | C17H11ClF3N3O2S |
| Molecular Weight | 413.81 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 3-chloro-N-[(Z)-(1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbutan-2-ylidene)amino]-1H-indole-2-carboxamide |
| SMILES | O=C(C/C(=N/NC(=O)c1[nH]c2ccccc2c1Cl)C(F)(F)F)c1cccs1 |
| InChI | InChI=1S/C17H11ClF3N3O2S/c18-14-9-4-1-2-5-10(9)22-15(14)16(26)24-23-13(17(19,20)21)8-11(25)12-6-3-7-27-12/h1-7,22H,8H2,(H,24,26)/b23-13- |
| InChIKey | CLPHHYBQGJQNGW-QRVIBDJDSA-N |
| XLogP | 4.80 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.81 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|