amino 3-oxo-3-thiophen-2-ylpropanoate

C7H7NO3S — CID 68635142

IUPACamino 3-oxo-3-thiophen-2-ylpropanoate
SMILESNOC(=O)CC(=O)c1cccs1
InChIInChI=1S/C7H7NO3S/c8-11-7(10)4-5(9)6-2-1-3-12-6/h1-3H,4,8H2
InChIKeyQWJFSEQNNJZZIA-UHFFFAOYSA-N
MW185.20 g/mol
LogP0.74
Rot. Bonds3

About amino 3-oxo-3-thiophen-2-ylpropanoate

amino 3-oxo-3-thiophen-2-ylpropanoate (PubChem CID 68635142) has the molecular formula C7H7NO3S and a molecular weight of 185.20 g/mol. Its IUPAC name is amino 3-oxo-3-thiophen-2-ylpropanoate.

Molecular Properties

Compound Nameamino 3-oxo-3-thiophen-2-ylpropanoate
PubChem CID68635142
Molecular FormulaC7H7NO3S
Molecular Weight185.20 g/mol
Exact Mass185.01
IUPAC Nameamino 3-oxo-3-thiophen-2-ylpropanoate
SMILESNOC(=O)CC(=O)c1cccs1
InChIInChI=1S/C7H7NO3S/c8-11-7(10)4-5(9)6-2-1-3-12-6/h1-3H,4,8H2
InChIKeyQWJFSEQNNJZZIA-UHFFFAOYSA-N
XLogP0.74
TPSA69.39 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.20
LogP ≤ 50.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze amino 3-oxo-3-thiophen-2-ylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of amino 3-oxo-3-thiophen-2-ylpropanoate?
The IUPAC name of amino 3-oxo-3-thiophen-2-ylpropanoate (CID 68635142) is amino 3-oxo-3-thiophen-2-ylpropanoate.
What is the SMILES notation for amino 3-oxo-3-thiophen-2-ylpropanoate?
The canonical SMILES for amino 3-oxo-3-thiophen-2-ylpropanoate is NOC(=O)CC(=O)c1cccs1.
What is the InChIKey of amino 3-oxo-3-thiophen-2-ylpropanoate?
The InChIKey is QWJFSEQNNJZZIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3S/c8-11-7(10)4-5(9)6-2-1-3-12-6/h1-3H,4,8H2.
What are the key properties of amino 3-oxo-3-thiophen-2-ylpropanoate?
amino 3-oxo-3-thiophen-2-ylpropanoate has a molecular weight of 185.20 g/mol, XLogP of 0.74, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for amino 3-oxo-3-thiophen-2-ylpropanoate is sourced from PubChem (CID 68635142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).