C11H15NO2S — CID 22925217
N,N-diethyl-3-oxo-3-thiophen-2-ylpropanamide (PubChem CID 22925217) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is N,N-diethyl-3-oxo-3-thiophen-2-ylpropanamide.
| Compound Name | N,N-diethyl-3-oxo-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 22925217 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | N,N-diethyl-3-oxo-3-thiophen-2-ylpropanamide |
| SMILES | CCN(CC)C(=O)CC(=O)c1cccs1 |
| InChI | InChI=1S/C11H15NO2S/c1-3-12(4-2)11(14)8-9(13)10-6-5-7-15-10/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | VMKJFCXZTCOOLZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|