C9H13NOS — CID 962897
N,N-diethylthiophene-2-carboxamide (PubChem CID 962897) has the molecular formula C9H13NOS and a molecular weight of 183.28 g/mol. Its IUPAC name is N,N-diethylthiophene-2-carboxamide.
| Compound Name | N,N-diethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 962897 |
| Molecular Formula | C9H13NOS |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | N,N-diethylthiophene-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1cccs1 |
| InChI | InChI=1S/C9H13NOS/c1-3-10(4-2)9(11)8-6-5-7-12-8/h5-7H,3-4H2,1-2H3 |
| InChIKey | WCCLKHNWHBFKDF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |