C9H7N3OS — CID 710672
N,N-bis(cyanomethyl)thiophene-2-carboxamide (PubChem CID 710672) has the molecular formula C9H7N3OS and a molecular weight of 205.24 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)thiophene-2-carboxamide.
| Compound Name | N,N-bis(cyanomethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 710672 |
| Molecular Formula | C9H7N3OS |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | N,N-bis(cyanomethyl)thiophene-2-carboxamide |
| SMILES | N#CCN(CC#N)C(=O)c1cccs1 |
| InChI | InChI=1S/C9H7N3OS/c10-3-5-12(6-4-11)9(13)8-2-1-7-14-8/h1-2,7H,5-6H2 |
| InChIKey | UKNXXMRBUFQJHI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|