C15H10BrN3OS — CID 52832567
5-(4-bromophenyl)-N,N-bis(cyanomethyl)thiophene-2-carboxamide (PubChem CID 52832567) has the molecular formula C15H10BrN3OS and a molecular weight of 360.24 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N,N-bis(cyanomethyl)thiophene-2-carboxamide.
| Compound Name | 5-(4-bromophenyl)-N,N-bis(cyanomethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 52832567 |
| Molecular Formula | C15H10BrN3OS |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | 5-(4-bromophenyl)-N,N-bis(cyanomethyl)thiophene-2-carboxamide |
| SMILES | N#CCN(CC#N)C(=O)c1ccc(-c2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C15H10BrN3OS/c16-12-3-1-11(2-4-12)13-5-6-14(21-13)15(20)19(9-7-17)10-8-18/h1-6H,9-10H2 |
| InChIKey | QGABUWAJCWIVGL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|