C20H17BrN2O2S — CID 38496186
5-(4-bromophenyl)-N-[[4-(methylcarbamoyl)phenyl]methyl]thiophene-2-carboxamide (PubChem CID 38496186) has the molecular formula C20H17BrN2O2S and a molecular weight of 429.34 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-[[4-(methylcarbamoyl)phenyl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-(4-bromophenyl)-N-[[4-(methylcarbamoyl)phenyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 38496186 |
| Molecular Formula | C20H17BrN2O2S |
| Molecular Weight | 429.34 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 5-(4-bromophenyl)-N-[[4-(methylcarbamoyl)phenyl]methyl]thiophene-2-carboxamide |
| SMILES | CNC(=O)c1ccc(CNC(=O)c2ccc(-c3ccc(Br)cc3)s2)cc1 |
| InChI | InChI=1S/C20H17BrN2O2S/c1-22-19(24)15-4-2-13(3-5-15)12-23-20(25)18-11-10-17(26-18)14-6-8-16(21)9-7-14/h2-11H,12H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | LIKSOUKGVPJPMA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.34 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |