C12H9BrClNOS — CID 62276684
N-[(4-bromophenyl)methyl]-5-chlorothiophene-2-carboxamide (PubChem CID 62276684) has the molecular formula C12H9BrClNOS and a molecular weight of 330.63 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[(4-bromophenyl)methyl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 62276684 |
| Molecular Formula | C12H9BrClNOS |
| Molecular Weight | 330.63 g/mol |
| Exact Mass | 328.93 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-5-chlorothiophene-2-carboxamide |
| SMILES | O=C(NCc1ccc(Br)cc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C12H9BrClNOS/c13-9-3-1-8(2-4-9)7-15-12(16)10-5-6-11(14)17-10/h1-6H,7H2,(H,15,16) |
| InChIKey | FSLNPXWKTZAIHH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.63 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |