C16H16ClNO4S — CID 119246993
4-[4-[[(5-chlorothiophene-2-carbonyl)amino]methyl]phenoxy]butanoic acid (PubChem CID 119246993) has the molecular formula C16H16ClNO4S and a molecular weight of 353.83 g/mol. Its IUPAC name is 4-[4-[[(5-chlorothiophene-2-carbonyl)amino]methyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[[(5-chlorothiophene-2-carbonyl)amino]methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 119246993 |
| Molecular Formula | C16H16ClNO4S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 4-[4-[[(5-chlorothiophene-2-carbonyl)amino]methyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1ccc(CNC(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C16H16ClNO4S/c17-14-8-7-13(23-14)16(21)18-10-11-3-5-12(6-4-11)22-9-1-2-15(19)20/h3-8H,1-2,9-10H2,(H,18,21)(H,19,20) |
| InChIKey | KSUYEKWJEFWOME-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|