C18H21NO5S — CID 119247225
4-[4-[[(3-methoxy-5-methylthiophene-2-carbonyl)amino]methyl]phenoxy]butanoic acid (PubChem CID 119247225) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is 4-[4-[[(3-methoxy-5-methylthiophene-2-carbonyl)amino]methyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[[(3-methoxy-5-methylthiophene-2-carbonyl)amino]methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 119247225 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 4-[4-[[(3-methoxy-5-methylthiophene-2-carbonyl)amino]methyl]phenoxy]butanoic acid |
| SMILES | COc1cc(C)sc1C(=O)NCc1ccc(OCCCC(=O)O)cc1 |
| InChI | InChI=1S/C18H21NO5S/c1-12-10-15(23-2)17(25-12)18(22)19-11-13-5-7-14(8-6-13)24-9-3-4-16(20)21/h5-8,10H,3-4,9,11H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | SQWGKBLCWKGZRS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|