C12H8Br3NOS — CID 80536714
4,5-dibromo-N-[(4-bromophenyl)methyl]thiophene-2-carboxamide (PubChem CID 80536714) has the molecular formula C12H8Br3NOS and a molecular weight of 453.98 g/mol. Its IUPAC name is 4,5-dibromo-N-[(4-bromophenyl)methyl]thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-[(4-bromophenyl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 80536714 |
| Molecular Formula | C12H8Br3NOS |
| Molecular Weight | 453.98 g/mol |
| Exact Mass | 450.79 |
| IUPAC Name | 4,5-dibromo-N-[(4-bromophenyl)methyl]thiophene-2-carboxamide |
| SMILES | O=C(NCc1ccc(Br)cc1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H8Br3NOS/c13-8-3-1-7(2-4-8)6-16-12(17)10-5-9(14)11(15)18-10/h1-5H,6H2,(H,16,17) |
| InChIKey | HGIVRNHGSRSXDS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.98 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |