C7H6Br2N2O2S — CID 60668533
N-(2-amino-2-oxoethyl)-4,5-dibromothiophene-2-carboxamide (PubChem CID 60668533) has the molecular formula C7H6Br2N2O2S and a molecular weight of 342.01 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4,5-dibromothiophene-2-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4,5-dibromothiophene-2-carboxamide |
|---|---|
| PubChem CID | 60668533 |
| Molecular Formula | C7H6Br2N2O2S |
| Molecular Weight | 342.01 g/mol |
| Exact Mass | 339.85 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4,5-dibromothiophene-2-carboxamide |
| SMILES | NC(=O)CNC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C7H6Br2N2O2S/c8-3-1-4(14-6(3)9)7(13)11-2-5(10)12/h1H,2H2,(H2,10,12)(H,11,13) |
| InChIKey | MNYDHVKPJKXBRO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.01 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |