C9H10Br2N2O2S — CID 115649755
N-(4-amino-4-oxobutan-2-yl)-4,5-dibromothiophene-2-carboxamide (PubChem CID 115649755) has the molecular formula C9H10Br2N2O2S and a molecular weight of 370.07 g/mol. Its IUPAC name is N-(4-amino-4-oxobutan-2-yl)-4,5-dibromothiophene-2-carboxamide.
| Compound Name | N-(4-amino-4-oxobutan-2-yl)-4,5-dibromothiophene-2-carboxamide |
|---|---|
| PubChem CID | 115649755 |
| Molecular Formula | C9H10Br2N2O2S |
| Molecular Weight | 370.07 g/mol |
| Exact Mass | 367.88 |
| IUPAC Name | N-(4-amino-4-oxobutan-2-yl)-4,5-dibromothiophene-2-carboxamide |
| SMILES | CC(CC(N)=O)NC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C9H10Br2N2O2S/c1-4(2-7(12)14)13-9(15)6-3-5(10)8(11)16-6/h3-4H,2H2,1H3,(H2,12,14)(H,13,15) |
| InChIKey | BHNHDPMCNYNUFH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.07 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |