C11H15Br2NOS — CID 80536678
4,5-dibromo-N-(4-methylpentan-2-yl)thiophene-2-carboxamide (PubChem CID 80536678) has the molecular formula C11H15Br2NOS and a molecular weight of 369.12 g/mol. Its IUPAC name is 4,5-dibromo-N-(4-methylpentan-2-yl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(4-methylpentan-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 80536678 |
| Molecular Formula | C11H15Br2NOS |
| Molecular Weight | 369.12 g/mol |
| Exact Mass | 366.92 |
| IUPAC Name | 4,5-dibromo-N-(4-methylpentan-2-yl)thiophene-2-carboxamide |
| SMILES | CC(C)CC(C)NC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C11H15Br2NOS/c1-6(2)4-7(3)14-11(15)9-5-8(12)10(13)16-9/h5-7H,4H2,1-3H3,(H,14,15) |
| InChIKey | AGKMLWISPWPXCJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.12 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |