C12H11Br2NOS2 — CID 112726741
4,5-dibromo-N-(1-thiophen-2-ylpropan-2-yl)thiophene-2-carboxamide (PubChem CID 112726741) has the molecular formula C12H11Br2NOS2 and a molecular weight of 409.17 g/mol. Its IUPAC name is 4,5-dibromo-N-(1-thiophen-2-ylpropan-2-yl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(1-thiophen-2-ylpropan-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 112726741 |
| Molecular Formula | C12H11Br2NOS2 |
| Molecular Weight | 409.17 g/mol |
| Exact Mass | 406.86 |
| IUPAC Name | 4,5-dibromo-N-(1-thiophen-2-ylpropan-2-yl)thiophene-2-carboxamide |
| SMILES | CC(Cc1cccs1)NC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H11Br2NOS2/c1-7(5-8-3-2-4-17-8)15-12(16)10-6-9(13)11(14)18-10/h2-4,6-7H,5H2,1H3,(H,15,16) |
| InChIKey | RSNHNZJEYRQNJA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.17 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |