C15H16BrNOS — CID 79467456
3-bromo-4-methyl-N-(1-thiophen-2-ylpropan-2-yl)benzamide (PubChem CID 79467456) has the molecular formula C15H16BrNOS and a molecular weight of 338.27 g/mol. Its IUPAC name is 3-bromo-4-methyl-N-(1-thiophen-2-ylpropan-2-yl)benzamide.
| Compound Name | 3-bromo-4-methyl-N-(1-thiophen-2-ylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 79467456 |
| Molecular Formula | C15H16BrNOS |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 3-bromo-4-methyl-N-(1-thiophen-2-ylpropan-2-yl)benzamide |
| SMILES | Cc1ccc(C(=O)NC(C)Cc2cccs2)cc1Br |
| InChI | InChI=1S/C15H16BrNOS/c1-10-5-6-12(9-14(10)16)15(18)17-11(2)8-13-4-3-7-19-13/h3-7,9,11H,8H2,1-2H3,(H,17,18) |
| InChIKey | ZSONYEYRZKOLLJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |