C14H13Cl2NOS — CID 18711929
3,4-dichloro-N-(1-thiophen-2-ylpropan-2-yl)benzamide (PubChem CID 18711929) has the molecular formula C14H13Cl2NOS and a molecular weight of 314.24 g/mol. Its IUPAC name is 3,4-dichloro-N-(1-thiophen-2-ylpropan-2-yl)benzamide.
| Compound Name | 3,4-dichloro-N-(1-thiophen-2-ylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 18711929 |
| Molecular Formula | C14H13Cl2NOS |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 3,4-dichloro-N-(1-thiophen-2-ylpropan-2-yl)benzamide |
| SMILES | CC(Cc1cccs1)NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H13Cl2NOS/c1-9(7-11-3-2-6-19-11)17-14(18)10-4-5-12(15)13(16)8-10/h2-6,8-9H,7H2,1H3,(H,17,18) |
| InChIKey | MOWXLROQHVHQCD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |