C13H19Br2NOS — CID 71627844
4,5-dibromo-N-(6-methylheptan-2-yl)thiophene-2-carboxamide (PubChem CID 71627844) has the molecular formula C13H19Br2NOS and a molecular weight of 397.18 g/mol. Its IUPAC name is 4,5-dibromo-N-(6-methylheptan-2-yl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(6-methylheptan-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 71627844 |
| Molecular Formula | C13H19Br2NOS |
| Molecular Weight | 397.18 g/mol |
| Exact Mass | 394.96 |
| IUPAC Name | 4,5-dibromo-N-(6-methylheptan-2-yl)thiophene-2-carboxamide |
| SMILES | CC(C)CCCC(C)NC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C13H19Br2NOS/c1-8(2)5-4-6-9(3)16-13(17)11-7-10(14)12(15)18-11/h7-9H,4-6H2,1-3H3,(H,16,17) |
| InChIKey | SVCZCUOUPXUJOJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.18 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |