C11H13Br2NO3S — CID 43240005
2-[(4,5-dibromothiophene-2-carbonyl)amino]-3-methylpentanoic acid (PubChem CID 43240005) has the molecular formula C11H13Br2NO3S and a molecular weight of 399.10 g/mol. Its IUPAC name is 2-[(4,5-dibromothiophene-2-carbonyl)amino]-3-methylpentanoic acid.
| Compound Name | 2-[(4,5-dibromothiophene-2-carbonyl)amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 43240005 |
| Molecular Formula | C11H13Br2NO3S |
| Molecular Weight | 399.10 g/mol |
| Exact Mass | 396.90 |
| IUPAC Name | 2-[(4,5-dibromothiophene-2-carbonyl)amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)c1cc(Br)c(Br)s1)C(=O)O |
| InChI | InChI=1S/C11H13Br2NO3S/c1-3-5(2)8(11(16)17)14-10(15)7-4-6(12)9(13)18-7/h4-5,8H,3H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | QVVSRDMUHSZILZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.10 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |