C10H13Br2NO2S — CID 78997601
4,5-dibromo-N-(1-methoxybutan-2-yl)thiophene-2-carboxamide (PubChem CID 78997601) has the molecular formula C10H13Br2NO2S and a molecular weight of 371.09 g/mol. Its IUPAC name is 4,5-dibromo-N-(1-methoxybutan-2-yl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(1-methoxybutan-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 78997601 |
| Molecular Formula | C10H13Br2NO2S |
| Molecular Weight | 371.09 g/mol |
| Exact Mass | 368.90 |
| IUPAC Name | 4,5-dibromo-N-(1-methoxybutan-2-yl)thiophene-2-carboxamide |
| SMILES | CCC(COC)NC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C10H13Br2NO2S/c1-3-6(5-15-2)13-10(14)8-4-7(11)9(12)16-8/h4,6H,3,5H2,1-2H3,(H,13,14) |
| InChIKey | VCEXXKUTFFSMJG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.09 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |