C11H9Br2NO2S — CID 17480059
4,5-dibromo-N-[1-(furan-2-yl)ethyl]thiophene-2-carboxamide (PubChem CID 17480059) has the molecular formula C11H9Br2NO2S and a molecular weight of 379.07 g/mol. Its IUPAC name is 4,5-dibromo-N-[1-(furan-2-yl)ethyl]thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-[1-(furan-2-yl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17480059 |
| Molecular Formula | C11H9Br2NO2S |
| Molecular Weight | 379.07 g/mol |
| Exact Mass | 376.87 |
| IUPAC Name | 4,5-dibromo-N-[1-(furan-2-yl)ethyl]thiophene-2-carboxamide |
| SMILES | CC(NC(=O)c1cc(Br)c(Br)s1)c1ccco1 |
| InChI | InChI=1S/C11H9Br2NO2S/c1-6(8-3-2-4-16-8)14-11(15)9-5-7(12)10(13)17-9/h2-6H,1H3,(H,14,15) |
| InChIKey | PQWRMEJJICNUGH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.07 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |