C14H10Br2N2OS — CID 47161738
4,5-dibromo-N-[1-(4-cyanophenyl)ethyl]thiophene-2-carboxamide (PubChem CID 47161738) has the molecular formula C14H10Br2N2OS and a molecular weight of 414.12 g/mol. Its IUPAC name is 4,5-dibromo-N-[1-(4-cyanophenyl)ethyl]thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-[1-(4-cyanophenyl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 47161738 |
| Molecular Formula | C14H10Br2N2OS |
| Molecular Weight | 414.12 g/mol |
| Exact Mass | 411.89 |
| IUPAC Name | 4,5-dibromo-N-[1-(4-cyanophenyl)ethyl]thiophene-2-carboxamide |
| SMILES | CC(NC(=O)c1cc(Br)c(Br)s1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H10Br2N2OS/c1-8(10-4-2-9(7-17)3-5-10)18-14(19)12-6-11(15)13(16)20-12/h2-6,8H,1H3,(H,18,19) |
| InChIKey | LCGZLSMVSOTHMF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.12 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |