C16H16N2OS — CID 47161800
N-[1-(4-cyanophenyl)ethyl]-2,5-dimethylthiophene-3-carboxamide (PubChem CID 47161800) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is N-[1-(4-cyanophenyl)ethyl]-2,5-dimethylthiophene-3-carboxamide.
| Compound Name | N-[1-(4-cyanophenyl)ethyl]-2,5-dimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 47161800 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-[1-(4-cyanophenyl)ethyl]-2,5-dimethylthiophene-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC(C)c2ccc(C#N)cc2)c(C)s1 |
| InChI | InChI=1S/C16H16N2OS/c1-10-8-15(12(3)20-10)16(19)18-11(2)14-6-4-13(9-17)5-7-14/h4-8,11H,1-3H3,(H,18,19) |
| InChIKey | DMUGZVGXODXBOG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |