C10H14BrN3O2 — CID 115666649
N-(4-amino-4-oxobutan-2-yl)-4-bromo-1-methylpyrrole-2-carboxamide (PubChem CID 115666649) has the molecular formula C10H14BrN3O2 and a molecular weight of 288.14 g/mol. Its IUPAC name is N-(4-amino-4-oxobutan-2-yl)-4-bromo-1-methylpyrrole-2-carboxamide.
| Compound Name | N-(4-amino-4-oxobutan-2-yl)-4-bromo-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 115666649 |
| Molecular Formula | C10H14BrN3O2 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | N-(4-amino-4-oxobutan-2-yl)-4-bromo-1-methylpyrrole-2-carboxamide |
| SMILES | CC(CC(N)=O)NC(=O)c1cc(Br)cn1C |
| InChI | InChI=1S/C10H14BrN3O2/c1-6(3-9(12)15)13-10(16)8-4-7(11)5-14(8)2/h4-6H,3H2,1-2H3,(H2,12,15)(H,13,16) |
| InChIKey | YVMKCCGOCZOABO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |