C13H19BrN2O3 — CID 60701457
methyl 2-[(4-bromo-1-methylpyrrole-2-carbonyl)amino]-3-methylpentanoate (PubChem CID 60701457) has the molecular formula C13H19BrN2O3 and a molecular weight of 331.21 g/mol. Its IUPAC name is methyl 2-[(4-bromo-1-methylpyrrole-2-carbonyl)amino]-3-methylpentanoate.
| Compound Name | methyl 2-[(4-bromo-1-methylpyrrole-2-carbonyl)amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 60701457 |
| Molecular Formula | C13H19BrN2O3 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | methyl 2-[(4-bromo-1-methylpyrrole-2-carbonyl)amino]-3-methylpentanoate |
| SMILES | CCC(C)C(NC(=O)c1cc(Br)cn1C)C(=O)OC |
| InChI | InChI=1S/C13H19BrN2O3/c1-5-8(2)11(13(18)19-4)15-12(17)10-6-9(14)7-16(10)3/h6-8,11H,5H2,1-4H3,(H,15,17) |
| InChIKey | ZZTAEYQYTCLFCU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |