C11H15BrN2O3 — CID 81063480
4-[(4-bromo-1-methylpyrrole-2-carbonyl)amino]-3-methylbutanoic acid (PubChem CID 81063480) has the molecular formula C11H15BrN2O3 and a molecular weight of 303.16 g/mol. Its IUPAC name is 4-[(4-bromo-1-methylpyrrole-2-carbonyl)amino]-3-methylbutanoic acid.
| Compound Name | 4-[(4-bromo-1-methylpyrrole-2-carbonyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 81063480 |
| Molecular Formula | C11H15BrN2O3 |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 4-[(4-bromo-1-methylpyrrole-2-carbonyl)amino]-3-methylbutanoic acid |
| SMILES | CC(CNC(=O)c1cc(Br)cn1C)CC(=O)O |
| InChI | InChI=1S/C11H15BrN2O3/c1-7(3-10(15)16)5-13-11(17)9-4-8(12)6-14(9)2/h4,6-7H,3,5H2,1-2H3,(H,13,17)(H,15,16) |
| InChIKey | JIAHDBABCLBAAH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |