C13H10Br2N2O2S — CID 39280552
N-[4-(2-amino-2-oxoethyl)phenyl]-4,5-dibromothiophene-2-carboxamide (PubChem CID 39280552) has the molecular formula C13H10Br2N2O2S and a molecular weight of 418.11 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethyl)phenyl]-4,5-dibromothiophene-2-carboxamide.
| Compound Name | N-[4-(2-amino-2-oxoethyl)phenyl]-4,5-dibromothiophene-2-carboxamide |
|---|---|
| PubChem CID | 39280552 |
| Molecular Formula | C13H10Br2N2O2S |
| Molecular Weight | 418.11 g/mol |
| Exact Mass | 415.88 |
| IUPAC Name | N-[4-(2-amino-2-oxoethyl)phenyl]-4,5-dibromothiophene-2-carboxamide |
| SMILES | NC(=O)Cc1ccc(NC(=O)c2cc(Br)c(Br)s2)cc1 |
| InChI | InChI=1S/C13H10Br2N2O2S/c14-9-6-10(20-12(9)15)13(19)17-8-3-1-7(2-4-8)5-11(16)18/h1-4,6H,5H2,(H2,16,18)(H,17,19) |
| InChIKey | QKALPOWIZOVQBG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.11 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |