C14H12Br2ClNO2S — CID 114302887
4,5-dibromo-N-[3-(chloromethyl)-4-ethoxyphenyl]thiophene-2-carboxamide (PubChem CID 114302887) has the molecular formula C14H12Br2ClNO2S and a molecular weight of 453.58 g/mol. Its IUPAC name is 4,5-dibromo-N-[3-(chloromethyl)-4-ethoxyphenyl]thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-[3-(chloromethyl)-4-ethoxyphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 114302887 |
| Molecular Formula | C14H12Br2ClNO2S |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 450.86 |
| IUPAC Name | 4,5-dibromo-N-[3-(chloromethyl)-4-ethoxyphenyl]thiophene-2-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cc(Br)c(Br)s2)cc1CCl |
| InChI | InChI=1S/C14H12Br2ClNO2S/c1-2-20-11-4-3-9(5-8(11)7-17)18-14(19)12-6-10(15)13(16)21-12/h3-6H,2,7H2,1H3,(H,18,19) |
| InChIKey | JXOGOJZQWOZHAI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|