C13H11Br2NOS — CID 54557430
4,5-dibromo-N-(3,4-dimethylphenyl)thiophene-2-carboxamide (PubChem CID 54557430) has the molecular formula C13H11Br2NOS and a molecular weight of 389.11 g/mol. Its IUPAC name is 4,5-dibromo-N-(3,4-dimethylphenyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(3,4-dimethylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 54557430 |
| Molecular Formula | C13H11Br2NOS |
| Molecular Weight | 389.11 g/mol |
| Exact Mass | 386.89 |
| IUPAC Name | 4,5-dibromo-N-(3,4-dimethylphenyl)thiophene-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(Br)c(Br)s2)cc1C |
| InChI | InChI=1S/C13H11Br2NOS/c1-7-3-4-9(5-8(7)2)16-13(17)11-6-10(14)12(15)18-11/h3-6H,1-2H3,(H,16,17) |
| InChIKey | ZODMMFYTDLCMLN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.11 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |