C11H7Br3N2OS — CID 114050470
4,5-dibromo-N-(6-bromo-5-methyl-3-pyridinyl)thiophene-2-carboxamide (PubChem CID 114050470) has the molecular formula C11H7Br3N2OS and a molecular weight of 454.97 g/mol. Its IUPAC name is 4,5-dibromo-N-(6-bromo-5-methyl-3-pyridinyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(6-bromo-5-methyl-3-pyridinyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 114050470 |
| Molecular Formula | C11H7Br3N2OS |
| Molecular Weight | 454.97 g/mol |
| Exact Mass | 451.78 |
| IUPAC Name | 4,5-dibromo-N-(6-bromo-5-methyl-3-pyridinyl)thiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cc(Br)c(Br)s2)cnc1Br |
| InChI | InChI=1S/C11H7Br3N2OS/c1-5-2-6(4-15-9(5)13)16-11(17)8-3-7(12)10(14)18-8/h2-4H,1H3,(H,16,17) |
| InChIKey | SLNCSVHWAKIALL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.97 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|