C13H7Br2N3OS — CID 47254936
4,5-dibromo-N-quinoxalin-6-ylthiophene-2-carboxamide (PubChem CID 47254936) has the molecular formula C13H7Br2N3OS and a molecular weight of 413.09 g/mol. Its IUPAC name is 4,5-dibromo-N-quinoxalin-6-ylthiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-quinoxalin-6-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 47254936 |
| Molecular Formula | C13H7Br2N3OS |
| Molecular Weight | 413.09 g/mol |
| Exact Mass | 410.87 |
| IUPAC Name | 4,5-dibromo-N-quinoxalin-6-ylthiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc2nccnc2c1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C13H7Br2N3OS/c14-8-6-11(20-12(8)15)13(19)18-7-1-2-9-10(5-7)17-4-3-16-9/h1-6H,(H,18,19) |
| InChIKey | LJFLSJJGLCKVCJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.09 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |