C13H10Br2N2O2S — CID 24635611
4,5-dibromo-N-[4-(methylcarbamoyl)phenyl]thiophene-2-carboxamide (PubChem CID 24635611) has the molecular formula C13H10Br2N2O2S and a molecular weight of 418.11 g/mol. Its IUPAC name is 4,5-dibromo-N-[4-(methylcarbamoyl)phenyl]thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-[4-(methylcarbamoyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 24635611 |
| Molecular Formula | C13H10Br2N2O2S |
| Molecular Weight | 418.11 g/mol |
| Exact Mass | 415.88 |
| IUPAC Name | 4,5-dibromo-N-[4-(methylcarbamoyl)phenyl]thiophene-2-carboxamide |
| SMILES | CNC(=O)c1ccc(NC(=O)c2cc(Br)c(Br)s2)cc1 |
| InChI | InChI=1S/C13H10Br2N2O2S/c1-16-12(18)7-2-4-8(5-3-7)17-13(19)10-6-9(14)11(15)20-10/h2-6H,1H3,(H,16,18)(H,17,19) |
| InChIKey | IBGPUGYRIMEBSJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.11 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |