C14H14BrN3O2S — CID 79959546
5-bromo-4-methyl-N-[4-(methylcarbamoylamino)phenyl]thiophene-2-carboxamide (PubChem CID 79959546) has the molecular formula C14H14BrN3O2S and a molecular weight of 368.26 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-[4-(methylcarbamoylamino)phenyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-4-methyl-N-[4-(methylcarbamoylamino)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 79959546 |
| Molecular Formula | C14H14BrN3O2S |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | 5-bromo-4-methyl-N-[4-(methylcarbamoylamino)phenyl]thiophene-2-carboxamide |
| SMILES | CNC(=O)Nc1ccc(NC(=O)c2cc(C)c(Br)s2)cc1 |
| InChI | InChI=1S/C14H14BrN3O2S/c1-8-7-11(21-12(8)15)13(19)17-9-3-5-10(6-4-9)18-14(20)16-2/h3-7H,1-2H3,(H,17,19)(H2,16,18,20) |
| InChIKey | QBAIIGJTOPWEPX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |