C12H10BrNO2S — CID 79989528
5-bromo-N-(3-hydroxyphenyl)-4-methylthiophene-2-carboxamide (PubChem CID 79989528) has the molecular formula C12H10BrNO2S and a molecular weight of 312.19 g/mol. Its IUPAC name is 5-bromo-N-(3-hydroxyphenyl)-4-methylthiophene-2-carboxamide.
| Compound Name | 5-bromo-N-(3-hydroxyphenyl)-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 79989528 |
| Molecular Formula | C12H10BrNO2S |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 310.96 |
| IUPAC Name | 5-bromo-N-(3-hydroxyphenyl)-4-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cccc(O)c2)sc1Br |
| InChI | InChI=1S/C12H10BrNO2S/c1-7-5-10(17-11(7)13)12(16)14-8-3-2-4-9(15)6-8/h2-6,15H,1H3,(H,14,16) |
| InChIKey | OLFKBHLLSPPHEK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |