C15H12BrN3OS — CID 79916381
5-bromo-4-methyl-N-(3-pyrazol-1-ylphenyl)thiophene-2-carboxamide (PubChem CID 79916381) has the molecular formula C15H12BrN3OS and a molecular weight of 362.25 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-(3-pyrazol-1-ylphenyl)thiophene-2-carboxamide.
| Compound Name | 5-bromo-4-methyl-N-(3-pyrazol-1-ylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 79916381 |
| Molecular Formula | C15H12BrN3OS |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 5-bromo-4-methyl-N-(3-pyrazol-1-ylphenyl)thiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cccc(-n3cccn3)c2)sc1Br |
| InChI | InChI=1S/C15H12BrN3OS/c1-10-8-13(21-14(10)16)15(20)18-11-4-2-5-12(9-11)19-7-3-6-17-19/h2-9H,1H3,(H,18,20) |
| InChIKey | OKEZXPRNPKVSIG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |