C14H13BrN2O3S — CID 79917096
methyl N-[3-[(5-bromo-4-methylthiophene-2-carbonyl)amino]phenyl]carbamate (PubChem CID 79917096) has the molecular formula C14H13BrN2O3S and a molecular weight of 369.24 g/mol. Its IUPAC name is methyl N-[3-[(5-bromo-4-methylthiophene-2-carbonyl)amino]phenyl]carbamate.
| Compound Name | methyl N-[3-[(5-bromo-4-methylthiophene-2-carbonyl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 79917096 |
| Molecular Formula | C14H13BrN2O3S |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | methyl N-[3-[(5-bromo-4-methylthiophene-2-carbonyl)amino]phenyl]carbamate |
| SMILES | COC(=O)Nc1cccc(NC(=O)c2cc(C)c(Br)s2)c1 |
| InChI | InChI=1S/C14H13BrN2O3S/c1-8-6-11(21-12(8)15)13(18)16-9-4-3-5-10(7-9)17-14(19)20-2/h3-7H,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | YPVAMJYRRBLSAI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |