C15H15BrN2O2S — CID 79914678
5-bromo-N-[3-(dimethylcarbamoyl)phenyl]-4-methylthiophene-2-carboxamide (PubChem CID 79914678) has the molecular formula C15H15BrN2O2S and a molecular weight of 367.27 g/mol. Its IUPAC name is 5-bromo-N-[3-(dimethylcarbamoyl)phenyl]-4-methylthiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[3-(dimethylcarbamoyl)phenyl]-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 79914678 |
| Molecular Formula | C15H15BrN2O2S |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 5-bromo-N-[3-(dimethylcarbamoyl)phenyl]-4-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cccc(C(=O)N(C)C)c2)sc1Br |
| InChI | InChI=1S/C15H15BrN2O2S/c1-9-7-12(21-13(9)16)14(19)17-11-6-4-5-10(8-11)15(20)18(2)3/h4-8H,1-3H3,(H,17,19) |
| InChIKey | ILXVKLSJFHSKMH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |