C14H13BrN2O2S — CID 79989759
5-bromo-N-[3-[(Z)-N-hydroxy-C-methylcarbonimidoyl]phenyl]-4-methylthiophene-2-carboxamide (PubChem CID 79989759) has the molecular formula C14H13BrN2O2S and a molecular weight of 353.24 g/mol. Its IUPAC name is 5-bromo-N-[3-[(Z)-N-hydroxy-C-methylcarbonimidoyl]phenyl]-4-methylthiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[3-[(Z)-N-hydroxy-C-methylcarbonimidoyl]phenyl]-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 79989759 |
| Molecular Formula | C14H13BrN2O2S |
| Molecular Weight | 353.24 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 5-bromo-N-[3-[(Z)-N-hydroxy-C-methylcarbonimidoyl]phenyl]-4-methylthiophene-2-carboxamide |
| SMILES | C/C(=N/O)c1cccc(NC(=O)c2cc(C)c(Br)s2)c1 |
| InChI | InChI=1S/C14H13BrN2O2S/c1-8-6-12(20-13(8)15)14(18)16-11-5-3-4-10(7-11)9(2)17-19/h3-7,19H,1-2H3,(H,16,18)/b17-9- |
| InChIKey | YVMTZUWXVKYZQY-MFOYZWKCSA-N |
| XLogP | 4.27 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.24 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|