C11H8Br2N2OS — CID 78984489
N-(4-aminophenyl)-4,5-dibromothiophene-2-carboxamide (PubChem CID 78984489) has the molecular formula C11H8Br2N2OS and a molecular weight of 376.07 g/mol. Its IUPAC name is N-(4-aminophenyl)-4,5-dibromothiophene-2-carboxamide.
| Compound Name | N-(4-aminophenyl)-4,5-dibromothiophene-2-carboxamide |
|---|---|
| PubChem CID | 78984489 |
| Molecular Formula | C11H8Br2N2OS |
| Molecular Weight | 376.07 g/mol |
| Exact Mass | 373.87 |
| IUPAC Name | N-(4-aminophenyl)-4,5-dibromothiophene-2-carboxamide |
| SMILES | Nc1ccc(NC(=O)c2cc(Br)c(Br)s2)cc1 |
| InChI | InChI=1S/C11H8Br2N2OS/c12-8-5-9(17-10(8)13)11(16)15-7-3-1-6(14)2-4-7/h1-5H,14H2,(H,15,16) |
| InChIKey | IITVSIVNEIKZIS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.07 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|