C12H7Br2N3OS — CID 80537159
N-(4-amino-2-cyanophenyl)-4,5-dibromothiophene-2-carboxamide (PubChem CID 80537159) has the molecular formula C12H7Br2N3OS and a molecular weight of 401.08 g/mol. Its IUPAC name is N-(4-amino-2-cyanophenyl)-4,5-dibromothiophene-2-carboxamide.
| Compound Name | N-(4-amino-2-cyanophenyl)-4,5-dibromothiophene-2-carboxamide |
|---|---|
| PubChem CID | 80537159 |
| Molecular Formula | C12H7Br2N3OS |
| Molecular Weight | 401.08 g/mol |
| Exact Mass | 398.87 |
| IUPAC Name | N-(4-amino-2-cyanophenyl)-4,5-dibromothiophene-2-carboxamide |
| SMILES | N#Cc1cc(N)ccc1NC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H7Br2N3OS/c13-8-4-10(19-11(8)14)12(18)17-9-2-1-7(16)3-6(9)5-15/h1-4H,16H2,(H,17,18) |
| InChIKey | UMPQAURYOLSMLR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.08 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|