C12H5Br2ClN2OS — CID 103811052
4,5-dibromo-N-(2-chloro-4-cyanophenyl)thiophene-2-carboxamide (PubChem CID 103811052) has the molecular formula C12H5Br2ClN2OS and a molecular weight of 420.51 g/mol. Its IUPAC name is 4,5-dibromo-N-(2-chloro-4-cyanophenyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(2-chloro-4-cyanophenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103811052 |
| Molecular Formula | C12H5Br2ClN2OS |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 417.82 |
| IUPAC Name | 4,5-dibromo-N-(2-chloro-4-cyanophenyl)thiophene-2-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2cc(Br)c(Br)s2)c(Cl)c1 |
| InChI | InChI=1S/C12H5Br2ClN2OS/c13-7-4-10(19-11(7)14)12(18)17-9-2-1-6(5-16)3-8(9)15/h1-4H,(H,17,18) |
| InChIKey | UIPFPNBJLLQLPJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |