C14H7Cl3N2O — CID 103799731
2,5-dichloro-N-(2-chloro-4-cyanophenyl)benzamide (PubChem CID 103799731) has the molecular formula C14H7Cl3N2O and a molecular weight of 325.58 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-chloro-4-cyanophenyl)benzamide.
| Compound Name | 2,5-dichloro-N-(2-chloro-4-cyanophenyl)benzamide |
|---|---|
| PubChem CID | 103799731 |
| Molecular Formula | C14H7Cl3N2O |
| Molecular Weight | 325.58 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | 2,5-dichloro-N-(2-chloro-4-cyanophenyl)benzamide |
| SMILES | N#Cc1ccc(NC(=O)c2cc(Cl)ccc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H7Cl3N2O/c15-9-2-3-11(16)10(6-9)14(20)19-13-4-1-8(7-18)5-12(13)17/h1-6H,(H,19,20) |
| InChIKey | IPFCDPCTEMGRKV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.58 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |