C14H9ClN2O3 — CID 107808194
N-(2-chloro-4-cyanophenyl)-2,6-dihydroxybenzamide (PubChem CID 107808194) has the molecular formula C14H9ClN2O3 and a molecular weight of 288.69 g/mol. Its IUPAC name is N-(2-chloro-4-cyanophenyl)-2,6-dihydroxybenzamide.
| Compound Name | N-(2-chloro-4-cyanophenyl)-2,6-dihydroxybenzamide |
|---|---|
| PubChem CID | 107808194 |
| Molecular Formula | C14H9ClN2O3 |
| Molecular Weight | 288.69 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | N-(2-chloro-4-cyanophenyl)-2,6-dihydroxybenzamide |
| SMILES | N#Cc1ccc(NC(=O)c2c(O)cccc2O)c(Cl)c1 |
| InChI | InChI=1S/C14H9ClN2O3/c15-9-6-8(7-16)4-5-10(9)17-14(20)13-11(18)2-1-3-12(13)19/h1-6,18-19H,(H,17,20) |
| InChIKey | WPNNIHBVYVZYDO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.69 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |