C11H5Br2N3OS — CID 78931923
4,5-dibromo-N-(5-cyano-2-pyridinyl)thiophene-2-carboxamide (PubChem CID 78931923) has the molecular formula C11H5Br2N3OS and a molecular weight of 387.06 g/mol. Its IUPAC name is 4,5-dibromo-N-(5-cyano-2-pyridinyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(5-cyano-2-pyridinyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 78931923 |
| Molecular Formula | C11H5Br2N3OS |
| Molecular Weight | 387.06 g/mol |
| Exact Mass | 384.85 |
| IUPAC Name | 4,5-dibromo-N-(5-cyano-2-pyridinyl)thiophene-2-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2cc(Br)c(Br)s2)nc1 |
| InChI | InChI=1S/C11H5Br2N3OS/c12-7-3-8(18-10(7)13)11(17)16-9-2-1-6(4-14)5-15-9/h1-3,5H,(H,15,16,17) |
| InChIKey | AOXUHFNLDFWFDU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.06 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |