C10H5Br3N2OS — CID 78971768
4,5-dibromo-N-(6-bromo-2-pyridinyl)thiophene-2-carboxamide (PubChem CID 78971768) has the molecular formula C10H5Br3N2OS and a molecular weight of 440.94 g/mol. Its IUPAC name is 4,5-dibromo-N-(6-bromo-2-pyridinyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(6-bromo-2-pyridinyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 78971768 |
| Molecular Formula | C10H5Br3N2OS |
| Molecular Weight | 440.94 g/mol |
| Exact Mass | 437.77 |
| IUPAC Name | 4,5-dibromo-N-(6-bromo-2-pyridinyl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(Br)n1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C10H5Br3N2OS/c11-5-4-6(17-9(5)13)10(16)15-8-3-1-2-7(12)14-8/h1-4H,(H,14,15,16) |
| InChIKey | AJDCYZKFHSLCGC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.94 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|