C11H4Br5NOS — CID 80536593
4,5-dibromo-N-(2,4,6-tribromophenyl)thiophene-2-carboxamide (PubChem CID 80536593) has the molecular formula C11H4Br5NOS and a molecular weight of 597.75 g/mol. Its IUPAC name is 4,5-dibromo-N-(2,4,6-tribromophenyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(2,4,6-tribromophenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 80536593 |
| Molecular Formula | C11H4Br5NOS |
| Molecular Weight | 597.75 g/mol |
| Exact Mass | 592.59 |
| IUPAC Name | 4,5-dibromo-N-(2,4,6-tribromophenyl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1c(Br)cc(Br)cc1Br)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C11H4Br5NOS/c12-4-1-5(13)9(6(14)2-4)17-11(18)8-3-7(15)10(16)19-8/h1-3H,(H,17,18) |
| InChIKey | NENKDGRMOPEGFV-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.75 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |